Identidade
Caffeic Acid Phenethyl Ester
Não indicado · C17H16O4
01Identidade
| Lazychem ID | LC-85590 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 5281787 |
| Molecular formula | C17H16O4 |
| Molecular weight | 284.31 g/mol |
| IUPAC name | 2-phenylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChIKey | SWUARLUWKZWEBQ-VQHVLOKHSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 5281787

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C=C1)CCOC(=O)/C=C/C2=CC(=C(C=C2)O)O |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 5281787
Structure and machine-readable chemical identifiers.
