Identidade
AS 604850
Não indicado · C11H5F2NO4S
01Identidade
| Lazychem ID | LC-85392 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 5287855 |
| Molecular formula | C11H5F2NO4S |
| Molecular weight | 285.23 g/mol |
| IUPAC name | (5Z)-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | SRLVNYDXMUGOFI-YWEYNIOJSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 5287855

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C(C=C1/C=C\3/C(=O)NC(=O)S3)OC(O2)(F)F |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 5287855
Structure and machine-readable chemical identifiers.
