Identidade
Ebe-A22
Não indicado · C17H16BrN3O2
01Identidade
| Lazychem ID | LC-85055 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 5328227 |
| Molecular formula | C17H16BrN3O2 |
| Molecular weight | 374.2 g/mol |
| IUPAC name | N-(3-bromophenyl)-6,7-dimethoxy-N-methylquinazolin-4-amine |
| InChIKey | IPWGDOZPSOZFOD-UHFFFAOYSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 5328227
The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(C1=CC(=CC=C1)Br)C2=NC=NC3=CC(=C(C=C32)OC)OC |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 5328227
Structure and machine-readable chemical identifiers.