Identidade
Disufenton
Não indicado · C11H15NO7S2
01Identidade
| Lazychem ID | LC-83666 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 6913176 |
| Molecular formula | C11H15NO7S2 |
| Molecular weight | 337.4 g/mol |
| IUPAC name | N-tert-butyl-1-(2,4-disulfophenyl)methanimine oxide |
| InChIKey | OVTCHWSLKGENKP-GHXNOFRVSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 6913176

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(C)(C)/[N+](=C/C1=C(C=C(C=C1)S(=O)(=O)O)S(=O)(=O)O)/[O-] |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 6913176
Structure and machine-readable chemical identifiers.
