Identidade
Bms453
Não indicado · C27H24O2
01Identidade
| Lazychem ID | LC-81788 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 9875424 |
| Molecular formula | C27H24O2 |
| Molecular weight | 380.5 g/mol |
| IUPAC name | 4-[(E)-2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethenyl]benzoic acid |
| InChIKey | VUODRPPTYLBGFM-CMDGGOBGSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 9875424
The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1(CC=C(C2=C1C=CC(=C2)/C=C/C3=CC=C(C=C3)C(=O)O)C4=CC=CC=C4)C |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 9875424
Structure and machine-readable chemical identifiers.