Identidade
T-5224
Não indicado · C29H27NO8
01Identidade
| Lazychem ID | LC-64458 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 23626877 |
| Molecular formula | C29H27NO8 |
| Molecular weight | 517.5 g/mol |
| IUPAC name | 3-[5-(4-cyclopentyloxy-2-hydroxybenzoyl)-2-[(3-oxo-1,2-benzoxazol-6-yl)methoxy]phenyl]propanoic acid |
| InChIKey | DALCQQSLNPLQFZ-UHFFFAOYSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 23626877

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1CCC(C1)OC2=CC(=C(C=C2)C(=O)C3=CC(=C(C=C3)OCC4=CC5=C(C=C4)C(=O)NO5)CCC(=O)O)O |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 23626877
Structure and machine-readable chemical identifiers.
