Identidade
Altiratinib
Não indicado · C26H21F3N4O4
01Identidade
| Lazychem ID | LC-57697 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 54576299 |
| Molecular formula | C26H21F3N4O4 |
| Molecular weight | 510.5 g/mol |
| IUPAC name | 1-N'-[4-[[2-(cyclopropanecarbonylamino)-4-pyridinyl]oxy]-2,5-difluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| InChIKey | GNNDEPIMDAZHRQ-UHFFFAOYSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 54576299

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1CC1C(=O)NC2=NC=CC(=C2)OC3=C(C=C(C(=C3)F)NC(=O)C4(CC4)C(=O)NC5=CC=C(C=C5)F)F |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 54576299
Structure and machine-readable chemical identifiers.
