Identidade
Decachlorobiphenyl
Não indicado · C12Cl10
01Identidade
| Lazychem ID | LC-53871 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 16318 |
| Molecular formula | C12Cl10 |
| Molecular weight | 498.6 g/mol |
| IUPAC name | 1,2,3,4,5-pentachloro-6-(2,3,4,5,6-pentachlorophenyl)benzene |
| InChIKey | ONXPZLFXDMAPRO-UHFFFAOYSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 16318

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 16318
Structure and machine-readable chemical identifiers.
