Identidade
2-Hydroxy-5-methyl-3-nitropyridine
Não indicado · C6H6N2O3
01Identidade
| Lazychem ID | LC-51133 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 345643 |
| Molecular formula | C6H6N2O3 |
| Molecular weight | 154.12 g/mol |
| IUPAC name | 5-methyl-3-nitro-1H-pyridin-2-one |
| InChIKey | QAINEQVHSHARMD-UHFFFAOYSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 345643

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=CNC(=O)C(=C1)[N+](=O)[O-] |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 345643
Structure and machine-readable chemical identifiers.
