Identidade
Ceftobiprole Impurity 40
Não indicado · C30H21N5O2S3
01Identidade
| Lazychem ID | LC-44980 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 12993643 |
| Molecular formula | C30H21N5O2S3 |
| Molecular weight | 579.7 g/mol |
| IUPAC name | S-(1,3-benzothiazol-2-yl) (2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoethanethioate |
| InChIKey | OOEJURIZMJWXJB-YQCHCMBFSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 12993643

The parsed structure contains 6 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 6 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O/N=C(\C4=NSC(=N4)N)/C(=O)SC5=NC6=CC=CC=C6S5 |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 12993643
Structure and machine-readable chemical identifiers.
