Identidade
2-(4-Fluorophenyl)-1-phenylethanone
Não indicado · C14H11FO
01Identidade
| Lazychem ID | LC-111401 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 236329 |
| Molecular formula | C14H11FO |
| Molecular weight | 214.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1-phenylethanone |
| InChIKey | CWYRBOMWOQXYFZ-UHFFFAOYSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 236329

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)F |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Não indicado
Nomes e relações
05Fontes
- S01PubChem CID 236329
Structure and machine-readable chemical identifiers.
