
Bromocriptine EP Impurity B / Alpha-Ergocryptine
CAS 511-09-1
YDOTUXAWKBPQJW-NSLWYYNWSA-N
Current configuration
Identidade
CAS 511-09-1 · C32H41N5O5
| Lazychem ID | LC-08817 |
|---|---|
| CAS RN | 511-09-1 |
| PubChem CID | 134551 |
| Molecular formula | C32H41N5O5 |
| Molecular weight | 575.71 g/mol |
| IUPAC name | (6aR,9R)-N-[(2R,5S,10aS,10bS)-10b-hydroxy-2-(1- methylethyl)-5-(2-methylpropyl)-3,6-dioxooctahydro- 8H-oxazolo[3,2-a]pyrrolo[2,1-c]pyrazin-2-yl]-7-methyl- 4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9- carboxamide |
| InChIKey | YDOTUXAWKBPQJW-NSLWYYNWSA-N |

The parsed structure contains 7 rings, includes aromatic atoms, includes aliphatic carbon, has 6 defined stereocentres. These statements are calculated from the published structure string.
| Defined stereocentres | 6 |
|---|---|
| Ring count | 7 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CC(C)C[C@H]1C(=O)N2CCC[C@H]2[C@]3(N1C(=O)[C@](O3)(C(C)C)NC(=O)[C@H]4CN([C@@H]5CC6=CNC7=CC=CC(=C67)C5=C4)C)O |
|---|---|
| InChI | Não indicado |
The published structure contains 6 defined and 0 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
These records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.

CAS 511-09-1
YDOTUXAWKBPQJW-NSLWYYNWSA-N
Current configuration


Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
Bromocriptine
Impurezas e compostos relacionadosStructure and machine-readable chemical identifiers.