Identidade
N-Nitroso Abemaciclib
Não indicado · C27H31F2N9O
01Identidade
| Lazychem ID | LC-21433 |
|---|---|
| CAS RN | Não indicado |
| PubChem CID | 172990564 |
| Molecular formula | C27H31F2N9O |
| Molecular weight | 535.59 g/mol |
| IUPAC name | N-(5-((4-ethylpiperazin-1-yl)methyl)pyridin-2-yl)-N-(5-fluoro-4-(4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazol-6-yl)pyrimidin-2-yl)nitrous amide |
| InChIKey | QKONLHCXQWQPEN-UHFFFAOYSA-N |
02Estrutura e estereoquímica
2D structurePubChem CID 172990564

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 3 |
| SMILES | CCN1CCN(CC2=CC=C(N(C3=NC=C(F)C(C4=CC(F)=C(N=C(C)N5C(C)C)C5=C4)=N3)N=O)N=C2)CC1 |
|---|---|
| InChI | Não indicado |
03Estado na Índia
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomes e relações
API e fármaco de origem
Abemaciclib
Impurezas e compostos relacionadosNomes e relações
- Abemaciclib Nitroso Impurity 1
05Fontes
- S01PubChem CID 172990564
Structure and machine-readable chemical identifiers.
