Tożsamość
ML348
Nie podano · C18H17ClF3N3O3
01Tożsamość
| Lazychem ID | LC-89292 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 3238952 |
| Molecular formula | C18H17ClF3N3O3 |
| Molecular weight | 415.8 g/mol |
| IUPAC name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
| InChIKey | OXKNHBBDOIMFFQ-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 3238952

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | C1CN(CCN1CC(=O)NC2=C(C=CC(=C2)C(F)(F)F)Cl)C(=O)C3=CC=CO3 |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 3238952
Structure and machine-readable chemical identifiers.
