Tożsamość
(2-Nitrophenyl)hydrazine
Nie podano · C6H7N3O2
01Tożsamość
| Lazychem ID | LC-89150 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 3314739 |
| Molecular formula | C6H7N3O2 |
| Molecular weight | 153.14 g/mol |
| IUPAC name | (2-nitrophenyl)hydrazine |
| InChIKey | FRBUNLLUASHNDJ-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 3314739

The parsed structure contains 1 ring, includes aromatic atoms, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C(=C1)NN)[N+](=O)[O-] |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 3314739
Structure and machine-readable chemical identifiers.
