Tożsamość
Benzidine dihydrochloride
Nie podano · C12H14Cl2N2
01Tożsamość
| Lazychem ID | LC-54094 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 10754 |
| Molecular formula | C12H14Cl2N2 |
| Molecular weight | 257.16 g/mol |
| IUPAC name | 4-(4-aminophenyl)aniline;dihydrochloride |
| InChIKey | RUAXWVDEYJEWRY-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 10754

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N)N.Cl.Cl |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 10754
Structure and machine-readable chemical identifiers.
