Tożsamość
Dehydro Isradipine
Nie podano · C19H19N3O5
01Tożsamość
| Lazychem ID | LC-47312 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 10406778 |
| Molecular formula | C19H19N3O5 |
| Molecular weight | 369.4 g/mol |
| IUPAC name | 5-O-methyl 3-O-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| InChIKey | XXUCEEUFISNYCI-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 10406778

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC(C)C)C2=CC=CC3=NON=C32)C(=O)OC |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 10406778
Structure and machine-readable chemical identifiers.
