Tożsamość
Dimethyl 4-hydroxyphthalate
Nie podano · C10H10O5
01Tożsamość
| Lazychem ID | LC-118731 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 89726 |
| Molecular formula | C10H10O5 |
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 4-hydroxybenzene-1,2-dicarboxylate |
| InChIKey | JJXVDRYFBGDXOU-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 89726

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC(=O)C1=C(C=C(C=C1)O)C(=O)OC |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 89726
Structure and machine-readable chemical identifiers.
