Tożsamość
3-Hydroxyphthalic anhydride
Nie podano · C8H4O4
01Tożsamość
| Lazychem ID | LC-117511 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 96580 |
| Molecular formula | C8H4O4 |
| Molecular weight | 164.11 g/mol |
| IUPAC name | 4-hydroxy-2-benzofuran-1,3-dione |
| InChIKey | CCTOEAMRIIXGDJ-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 96580

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)OC2=O |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 96580
Structure and machine-readable chemical identifiers.
