Tożsamość
Pemirolast Potassium
Nie podano · C10H7KN6O
01Tożsamość
| Lazychem ID | LC-107558 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 443866 |
| Molecular formula | C10H7KN6O |
| Molecular weight | 266.30 g/mol |
| IUPAC name | potassium 9-methyl-3-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | NMMVKSMGBDRONO-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 443866

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=CC=CN2C1=NC=C(C2=O)C3=NN=N[N-]3.[K+] |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 443866
Structure and machine-readable chemical identifiers.
