Tożsamość
2-Hydroxy-6-methyl-5-nitropyridine
Nie podano · C6H6N2O3
01Tożsamość
| Lazychem ID | LC-106293 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 543053 |
| Molecular formula | C6H6N2O3 |
| Molecular weight | 154.12 g/mol |
| IUPAC name | 6-methyl-5-nitro-1H-pyridin-2-one |
| InChIKey | AJDDHNXZBGZBJN-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 543053

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C=CC(=O)N1)[N+](=O)[O-] |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 543053
Structure and machine-readable chemical identifiers.
