Tożsamość
Nilotinib
Nie podano · C28H22F3N7O
01Tożsamość
| Lazychem ID | LC-103632 |
|---|---|
| CAS RN | Nie podano |
| PubChem CID | 644241 |
| Molecular formula | C28H22F3N7O |
| Molecular weight | 529.5 g/mol |
| IUPAC name | 4-methyl-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide |
| InChIKey | HHZIURLSWUIHRB-UHFFFAOYSA-N |
02Struktura i stereochemia
2D structurePubChem CID 644241
The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=CC(=CC(=C2)C(F)(F)F)N3C=C(N=C3)C)NC4=NC=CC(=N4)C5=CN=CC=C5 |
|---|---|
| InChI | Nie podano |
03Status w Indiach
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazwy i powiązania
API i lek macierzysty
Nie podano
Nazwy i powiązania
05Źródła
- S01PubChem CID 644241
Structure and machine-readable chemical identifiers.