Identiteit
Dimethyl dodecafluorosuberate
Niet vermeld · C10H6F12O4
01Identiteit
| Lazychem ID | LC-95604 |
|---|---|
| CAS RN | Niet vermeld |
| PubChem CID | 2737122 |
| Molecular formula | C10H6F12O4 |
| Molecular weight | 418.13 g/mol |
| IUPAC name | dimethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioate |
| InChIKey | SLFDDMXEAUAENU-UHFFFAOYSA-N |
02Structuur en stereochemie
2D structurePubChem CID 2737122

The parsed structure is acyclic, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC(=O)C(C(C(C(C(C(C(=O)OC)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
|---|---|
| InChI | Niet vermeld |
03Status in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen en relaties
API en moedergeneesmiddel
Niet vermeld
Namen en relaties
05Bronnen
- S01PubChem CID 2737122
Structure and machine-readable chemical identifiers.
