Identiteit
3-Bromoperylene
Niet vermeld · C20H11Br
01Identiteit
| Lazychem ID | LC-76388 |
|---|---|
| CAS RN | Niet vermeld |
| PubChem CID | 11809703 |
| Molecular formula | C20H11Br |
| Molecular weight | 331.2 g/mol |
| IUPAC name | 3-bromoperylene |
| InChIKey | GPBMCEWKAPSTOU-UHFFFAOYSA-N |
02Structuur en stereochemie
2D structurePubChem CID 11809703

The parsed structure contains 5 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C3C(=C1)C4=C5C(=CC=C4)C(=CC=C5C3=CC=C2)Br |
|---|---|
| InChI | Niet vermeld |
03Status in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen en relaties
API en moedergeneesmiddel
Niet vermeld
Namen en relaties
05Bronnen
- S01PubChem CID 11809703
Structure and machine-readable chemical identifiers.
