Identiteit
2,4-Dichloropteridine
Niet vermeld · C6H2Cl2N4
01Identiteit
| Lazychem ID | LC-60453 |
|---|---|
| CAS RN | Niet vermeld |
| PubChem CID | 45789707 |
| Molecular formula | C6H2Cl2N4 |
| Molecular weight | 201.01 g/mol |
| IUPAC name | 2,4-dichloropteridine |
| InChIKey | WVSQXWZADZZUSV-UHFFFAOYSA-N |
02Structuur en stereochemie
2D structurePubChem CID 45789707

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CN=C2C(=N1)C(=NC(=N2)Cl)Cl |
|---|---|
| InChI | Niet vermeld |
03Status in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen en relaties
API en moedergeneesmiddel
Niet vermeld
Namen en relaties
05Bronnen
- S01PubChem CID 45789707
Structure and machine-readable chemical identifiers.
