Identiteit
Methyl Ferulate
Niet vermeld · C11H12O4
01Identiteit
| Lazychem ID | LC-48943 |
|---|---|
| CAS RN | Niet vermeld |
| PubChem CID | 5357283 |
| Molecular formula | C11H12O4 |
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | AUJXJFHANFIVKH-GQCTYLIASA-N |
02Structuur en stereochemie
2D structurePubChem CID 5357283

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)OC)O |
|---|---|
| InChI | Niet vermeld |
03Status in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen en relaties
API en moedergeneesmiddel
Niet vermeld
Namen en relaties
05Bronnen
- S01PubChem CID 5357283
Structure and machine-readable chemical identifiers.
