Identiteit
Bms 182874
Niet vermeld · C17H19N3O3S
01Identiteit
| Lazychem ID | LC-115573 |
|---|---|
| CAS RN | Niet vermeld |
| PubChem CID | 122272 |
| Molecular formula | C17H19N3O3S |
| Molecular weight | 345.4 g/mol |
| IUPAC name | 5-(dimethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)naphthalene-1-sulfonamide |
| InChIKey | MJRGSRRZKSJHOE-UHFFFAOYSA-N |
02Structuur en stereochemie
2D structurePubChem CID 122272

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC3=C2C=CC=C3N(C)C |
|---|---|
| InChI | Niet vermeld |
03Status in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen en relaties
API en moedergeneesmiddel
Niet vermeld
Namen en relaties
05Bronnen
- S01PubChem CID 122272
Structure and machine-readable chemical identifiers.
