Identità
Dimethyl perfluorohexanedioate
Mhux elenkat · C8H6F8O4
01Identità
| Lazychem ID | LC-95605 |
|---|---|
| CAS RN | Mhux elenkat |
| PubChem CID | 2737117 |
| Molecular formula | C8H6F8O4 |
| Molecular weight | 318.12 g/mol |
| IUPAC name | dimethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate |
| InChIKey | XPXVIIILXUOEQA-UHFFFAOYSA-N |
02Struttura u stereokimika
2D structurePubChem CID 2737117

The parsed structure is acyclic, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC(=O)C(C(C(C(C(=O)OC)(F)F)(F)F)(F)F)(F)F |
|---|---|
| InChI | Mhux elenkat |
03Status fl-Indja
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ismijiet u relazzjonijiet
API u mediċina prinċipali
Mhux elenkat
Ismijiet u relazzjonijiet
05Sorsi
- S01PubChem CID 2737117
Structure and machine-readable chemical identifiers.
