Identità
Toremifene Citrate
Mhux elenkat · C32H36ClNO8
01Identità
| Lazychem ID | LC-90191 |
|---|---|
| CAS RN | Mhux elenkat |
| PubChem CID | 3005572 |
| Molecular formula | C32H36ClNO8 |
| Molecular weight | 598.1 g/mol |
| IUPAC name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | IWEQQRMGNVVKQW-OQKDUQJOSA-N |
02Struttura u stereokimika
2D structurePubChem CID 3005572

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(C)CCOC1=CC=C(C=C1)/C(=C(/CCCl)\C2=CC=CC=C2)/C3=CC=CC=C3.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
|---|---|
| InChI | Mhux elenkat |
03Status fl-Indja
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ismijiet u relazzjonijiet
API u mediċina prinċipali
Mhux elenkat
Ismijiet u relazzjonijiet
05Sorsi
- S01PubChem CID 3005572
Structure and machine-readable chemical identifiers.
