Identità
SB 204741
Mhux elenkat · C14H14N4OS
01Identità
| Lazychem ID | LC-89216 |
|---|---|
| CAS RN | Mhux elenkat |
| PubChem CID | 3277600 |
| Molecular formula | C14H14N4OS |
| Molecular weight | 286.35 g/mol |
| IUPAC name | 1-(1-methylindol-5-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea |
| InChIKey | USFUFHFQWXDVMH-UHFFFAOYSA-N |
02Struttura u stereokimika
2D structurePubChem CID 3277600

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=NSC(=C1)NC(=O)NC2=CC3=C(C=C2)N(C=C3)C |
|---|---|
| InChI | Mhux elenkat |
03Status fl-Indja
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ismijiet u relazzjonijiet
API u mediċina prinċipali
Mhux elenkat
Ismijiet u relazzjonijiet
05Sorsi
- S01PubChem CID 3277600
Structure and machine-readable chemical identifiers.
