Identità
Potassium hydrogen phthalate
Mhux elenkat · C8H5KO4
01Identità
| Lazychem ID | LC-64276 |
|---|---|
| CAS RN | Mhux elenkat |
| PubChem CID | 23676735 |
| Molecular formula | C8H5KO4 |
| Molecular weight | 204.22 g/mol |
| IUPAC name | potassium 2-carboxybenzoate |
| InChIKey | IWZKICVEHNUQTL-UHFFFAOYSA-M |
02Struttura u stereokimika
2D structurePubChem CID 23676735

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
|---|---|
| InChI | Mhux elenkat |
03Status fl-Indja
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ismijiet u relazzjonijiet
API u mediċina prinċipali
Mhux elenkat
Ismijiet u relazzjonijiet
05Sorsi
- S01PubChem CID 23676735
Structure and machine-readable chemical identifiers.
