Identità
Apixaban Impurity 258
Mhux elenkat · C24H22ClN5O3
01Identità
| Lazychem ID | LC-47557 |
|---|---|
| CAS RN | Mhux elenkat |
| PubChem CID | 10161894 |
| Molecular formula | C24H22ClN5O3 |
| Molecular weight | 463.9 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| InChIKey | PSUYNSYPEAMDPW-UHFFFAOYSA-N |
02Struttura u stereokimika
2D structurePubChem CID 10161894

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1CCN(C(=O)C1)C2=CC=C(C=C2)N3CCC4=C(C3=O)N(N=C4C(=O)N)C5=CC(=CC=C5)Cl |
|---|---|
| InChI | Mhux elenkat |
03Status fl-Indja
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ismijiet u relazzjonijiet
API u mediċina prinċipali
Mhux elenkat
Ismijiet u relazzjonijiet
05Sorsi
- S01PubChem CID 10161894
Structure and machine-readable chemical identifiers.
