Identità
2-methyl-3H-benzo[e]indole
Mhux elenkat · C13H11N
01Identità
| Lazychem ID | LC-43718 |
|---|---|
| CAS RN | Mhux elenkat |
| PubChem CID | 15556776 |
| Molecular formula | C13H11N |
| Molecular weight | 181.23 g/mol |
| IUPAC name | 2-methyl-3H-benzo[e]indole |
| InChIKey | UYCFPYUIFROLFH-UHFFFAOYSA-N |
02Struttura u stereokimika
2D structurePubChem CID 15556776
![Two-dimensional chemical structure of 2-methyl-3H-benzo[e]indole](/structures/pubchem/15556776-900.png)
The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=CC2=C(N1)C=CC3=CC=CC=C32 |
|---|---|
| InChI | Mhux elenkat |
03Status fl-Indja
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ismijiet u relazzjonijiet
API u mediċina prinċipali
Mhux elenkat
Ismijiet u relazzjonijiet
05Sorsi
- S01PubChem CID 15556776
Structure and machine-readable chemical identifiers.
