Identità
13-Hydroxyberberine
Mhux elenkat · C20H18ClNO5
01Identità
| Lazychem ID | LC-41775 |
|---|---|
| CAS RN | Mhux elenkat |
| PubChem CID | 24827073 |
| Molecular formula | C20H18ClNO5 |
| Molecular weight | 387.8 g/mol |
| IUPAC name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-ol chloride |
| InChIKey | SAFQLLBOPKXYLB-UHFFFAOYSA-N |
02Struttura u stereokimika
2D structurePubChem CID 24827073

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=C(C2=C[N+]3=C(C4=CC5=C(C=C4CC3)OCO5)C(=C2C=C1)O)OC.[Cl-] |
|---|---|
| InChI | Mhux elenkat |
03Status fl-Indja
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ismijiet u relazzjonijiet
API u mediċina prinċipali
Mhux elenkat
Ismijiet u relazzjonijiet
05Sorsi
- S01PubChem CID 24827073
Structure and machine-readable chemical identifiers.
