Identità
Moracin M
Mhux elenkat · C14H10O4
01Identità
| Lazychem ID | LC-112825 |
|---|---|
| CAS RN | Mhux elenkat |
| PubChem CID | 185848 |
| Molecular formula | C14H10O4 |
| Molecular weight | 242.23 g/mol |
| IUPAC name | 5-(6-hydroxy-1-benzofuran-2-yl)benzene-1,3-diol |
| InChIKey | LHPRYOJTASOZGJ-UHFFFAOYSA-N |
02Struttura u stereokimika
2D structurePubChem CID 185848

The parsed structure contains 3 rings, includes aromatic atoms. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C(C=C1O)OC(=C2)C3=CC(=CC(=C3)O)O |
|---|---|
| InChI | Mhux elenkat |
03Status fl-Indja
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ismijiet u relazzjonijiet
API u mediċina prinċipali
Mhux elenkat
Ismijiet u relazzjonijiet
05Sorsi
- S01PubChem CID 185848
Structure and machine-readable chemical identifiers.
