Identitāte
2',5-Dichloro-2-hydroxybenzophenone
Nav norādīts · C13H8Cl2O2
01Identitāte
| Lazychem ID | LC-96035 |
|---|---|
| CAS RN | Nav norādīts |
| PubChem CID | 2735995 |
| Molecular formula | C13H8Cl2O2 |
| Molecular weight | 267.10 g/mol |
| IUPAC name | (5-chloro-2-hydroxyphenyl)-(2-chlorophenyl)methanone |
| InChIKey | OSXVZDOVYCTYCW-UHFFFAOYSA-N |
02Struktūra un stereoķīmija
2D structurePubChem CID 2735995

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Cl)O)Cl |
|---|---|
| InChI | Nav norādīts |
03Statuss Indijā
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nosaukumi un saistības
API un pamatviela
Nav norādīts
Nosaukumi un saistības
05Avoti
- S01PubChem CID 2735995
Structure and machine-readable chemical identifiers.
