Identitāte
Coniferyl ferulate
Nav norādīts · C20H20O6
01Identitāte
| Lazychem ID | LC-84087 |
|---|---|
| CAS RN | Nav norādīts |
| PubChem CID | 6441913 |
| Molecular formula | C20H20O6 |
| Molecular weight | 356.4 g/mol |
| IUPAC name | [(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | PGLIMMMHQDNVRS-YZQQHVNFSA-N |
02Struktūra un stereoķīmija
2D structurePubChem CID 6441913

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=C(C=CC(=C1)/C=C/COC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O |
|---|---|
| InChI | Nav norādīts |
03Statuss Indijā
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nosaukumi un saistības
API un pamatviela
Nav norādīts
Nosaukumi un saistības
05Avoti
- S01PubChem CID 6441913
Structure and machine-readable chemical identifiers.
