Identitāte
Pluripotin
Nav norādīts · C27H25F3N8O2
01Identitāte
| Lazychem ID | LC-76087 |
|---|---|
| CAS RN | Nav norādīts |
| PubChem CID | 12003241 |
| Molecular formula | C27H25F3N8O2 |
| Molecular weight | 550.5 g/mol |
| IUPAC name | N-[3-[7-[(2,5-dimethylpyrazol-3-yl)amino]-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-3-yl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| InChIKey | NBZFRTJWEIHFPF-UHFFFAOYSA-N |
02Struktūra un stereoķīmija
2D structurePubChem CID 12003241

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)C(F)(F)F)N3CC4=CN=C(N=C4N(C3=O)C)NC5=CC(=NN5C)C |
|---|---|
| InChI | Nav norādīts |
03Statuss Indijā
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nosaukumi un saistības
API un pamatviela
Nav norādīts
Nosaukumi un saistības
05Avoti
- S01PubChem CID 12003241
Structure and machine-readable chemical identifiers.
