Identitāte
Phosphorylcholine Chloride
Nav norādīts · C5H15ClNO4P
01Identitāte
| Lazychem ID | LC-54264 |
|---|---|
| CAS RN | Nav norādīts |
| PubChem CID | 7886 |
| Molecular formula | C5H15ClNO4P |
| Molecular weight | 219.60 g/mol |
| IUPAC name | trimethyl(2-phosphonooxyethyl)azanium chloride |
| InChIKey | PYJNAPOPMIJKJZ-UHFFFAOYSA-N |
02Struktūra un stereoķīmija
2D structurePubChem CID 7886

The parsed structure is acyclic, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C[N+](C)(C)CCOP(=O)(O)O.[Cl-] |
|---|---|
| InChI | Nav norādīts |
03Statuss Indijā
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nosaukumi un saistības
API un pamatviela
Nav norādīts
Nosaukumi un saistības
05Avoti
- S01PubChem CID 7886
Structure and machine-readable chemical identifiers.
