Tapatybė
Methotrexate EP Impurity E
CAS 19741-14-1 · C15H15N7O2
01Tapatybė
| Lazychem ID | LC-19882 |
|---|---|
| CAS RN | 19741-14-1 |
| PubChem CID | 72441 |
| Molecular formula | C15H15N7O2 |
| Molecular weight | 325.3 g/mol |
| IUPAC name | 4-(((2,4-diaminopteridin-6-yl)methyl)(methyl)amino)benzoic acid |
| InChIKey | LWCXZSDKANNOAR-UHFFFAOYSA-N |
02Struktūra ir stereochemija
2D structurePubChem CID 72441

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | O=C(O)C1=CC=C(N(CC2=NC3=C(N)N=C(N)N=C3N=C2)C)C=C1 |
|---|---|
| InChI | Nenurodyta |
03Statusas Indijoje
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Pavadinimai ir ryšiai
API ir pirminis vaistas
Methotrexate
Priemaišos ir susiję junginiaiPavadinimai ir ryšiai
- Deoxyaminopteroic acid
- 4-Amino-4-deoxy-N10-methylpteroic acid
- 2,4-Diamino-N(10)-methylpteroic acid
05Šaltiniai
- S01PubChem CID 72441
Structure and machine-readable chemical identifiers.
