Tapatybė
Thiamethoxam Impurity 3
Nenurodyta · C14H15N5O3S2
01Tapatybė
| Lazychem ID | LC-42010 |
|---|---|
| CAS RN | Nenurodyta |
| PubChem CID | 23450651 |
| Molecular formula | C14H15N5O3S2 |
| Molecular weight | 365.4 g/mol |
| IUPAC name | (NE)-N-[3-methyl-5-[(2-phenylsulfanyl-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide |
| InChIKey | DPRKJAQMHKISEQ-DTQAZKPQSA-N |
02Struktūra ir stereochemija
2D structurePubChem CID 23450651

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains an N-nitroso substructure, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | CN\1COCN(/C1=N/[N+](=O)[O-])CC2=CN=C(S2)SC3=CC=CC=C3 |
|---|---|
| InChI | Nenurodyta |
03Statusas Indijoje
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Pavadinimai ir ryšiai
API ir pirminis vaistas
Nenurodyta
Pavadinimai ir ryšiai
05Šaltiniai
- S01PubChem CID 23450651
Structure and machine-readable chemical identifiers.
