
Tapatybė
Pasireotide Impurity 8
Nenurodyta · C58H66N10O9
01Tapatybė
| Lazychem ID | LC-39494 |
|---|---|
| CAS RN | Nenurodyta |
| PubChem CID | 59404426 |
| Molecular formula | C58H66N10O9 |
| Molecular weight | 1047.2 g/mol |
| IUPAC name | [(3S,6S,9S,12S,15S,18S,20R)-9-(4-aminobutyl)-3-benzyl-12-(1H-indol-3-ylmethyl)-2,5,8,11,14,17-hexaoxo-15-phenyl-6-[(4-phenylmethoxyphenyl)methyl]-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-20-yl] N-(2-aminoethyl)carbamate |
| InChIKey | VMZMNAABQBOLAK-OTAJABKISA-N |
02Struktūra ir stereochemija

The parsed structure contains 8 rings, includes aromatic atoms, includes aliphatic carbon, has 7 defined stereocentres. These statements are calculated from the published structure string.
| Defined stereocentres | 7 |
|---|---|
| Ring count | 8 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1[C@H](CN2[C@@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C2=O)CC3=CC=CC=C3)CC4=CC=C(C=C4)OCC5=CC=CC=C5)CCCCN)CC6=CNC7=CC=CC=C76)C8=CC=CC=C8)OC(=O)NCCN |
|---|---|
| InChI | Nenurodyta |
03Stereochemistry
The published structure contains 7 defined and 0 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
3 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.
Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Statusas Indijoje
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Pavadinimai ir ryšiai
API ir pirminis vaistas
Nenurodyta
Pavadinimai ir ryšiai
06Šaltiniai
- S01PubChem CID 59404426
Structure and machine-readable chemical identifiers.


