Tapatybė
Clomifene Citrate EP Impurity E
Nenurodyta · C26H27Cl2NO
01Tapatybė
| Lazychem ID | LC-38396 |
|---|---|
| CAS RN | Nenurodyta |
| PubChem CID | 71315614 |
| Molecular formula | C26H27Cl2NO |
| Molecular weight | 440.4 g/mol |
| IUPAC name | 2-[4-[(E)-1,2-bis(4-chlorophenyl)ethenyl]phenoxy]-N,N-diethylethanamine |
| InChIKey | BZAXUXUBRPKOSR-XHPQRKPJSA-N |
02Struktūra ir stereochemija
2D structurePubChem CID 71315614

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CCN(CC)CCOC1=CC=C(C=C1)/C(=C\C2=CC=C(C=C2)Cl)/C3=CC=C(C=C3)Cl |
|---|---|
| InChI | Nenurodyta |
03Statusas Indijoje
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Pavadinimai ir ryšiai
API ir pirminis vaistas
Nenurodyta
Pavadinimai ir ryšiai
05Šaltiniai
- S01PubChem CID 71315614
Structure and machine-readable chemical identifiers.
