Tapatybė
Dasatinib Impurity 29
Nenurodyta · C16H13Cl2N5OS
01Tapatybė
| Lazychem ID | LC-33809 |
|---|---|
| CAS RN | Nenurodyta |
| PubChem CID | 154631493 |
| Molecular formula | C16H13Cl2N5OS |
| Molecular weight | 394.3 g/mol |
| IUPAC name | 2-amino-N-(2-chloro-6-methylphenyl)-N-(6-chloro-2-methylpyrimidin-4-yl)-1,3-thiazole-5-carboxamide |
| InChIKey | POQXPSJMONKILM-UHFFFAOYSA-N |
02Struktūra ir stereochemija
2D structurePubChem CID 154631493

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C(=CC=C1)Cl)N(C2=CC(=NC(=N2)C)Cl)C(=O)C3=CN=C(S3)N |
|---|---|
| InChI | Nenurodyta |
03Statusas Indijoje
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Pavadinimai ir ryšiai
API ir pirminis vaistas
Nenurodyta
Pavadinimai ir ryšiai
05Šaltiniai
- S01PubChem CID 154631493
Structure and machine-readable chemical identifiers.
