Tapatybė
RU 59063
Nenurodyta · C17H18F3N3O2S
01Tapatybė
| Lazychem ID | LC-112625 |
|---|---|
| CAS RN | Nenurodyta |
| PubChem CID | 197655 |
| Molecular formula | C17H18F3N3O2S |
| Molecular weight | 385.4 g/mol |
| IUPAC name | 4-[3-(4-hydroxybutyl)-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| InChIKey | FIDNKDVRTLFETI-UHFFFAOYSA-N |
02Struktūra ir stereochemija
2D structurePubChem CID 197655

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CC1(C(=O)N(C(=S)N1CCCCO)C2=CC(=C(C=C2)C#N)C(F)(F)F)C |
|---|---|
| InChI | Nenurodyta |
03Statusas Indijoje
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Pavadinimai ir ryšiai
API ir pirminis vaistas
Nenurodyta
Pavadinimai ir ryšiai
05Šaltiniai
- S01PubChem CID 197655
Structure and machine-readable chemical identifiers.
