Tapatybė
Caffeine EP Impurity C
CAS 519-32-4 · C8H10N4O2
01Tapatybė
| Lazychem ID | LC-09137 |
|---|---|
| CAS RN | 519-32-4 |
| PubChem CID | 1326 |
| Molecular formula | C8H10N4O2 |
| Molecular weight | 194.19 g/mol |
| IUPAC name | 1,3,9-trimethyl-3,9-dihydro-1H-purine-2,6-dione |
| InChIKey | LPHGQDQBBGAPDZ-UHFFFAOYSA-N |
02Struktūra ir stereochemija
2D structurePubChem CID 1326

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | O=C(N1C)N(C)C2=C(N=CN2C)C1=O |
|---|---|
| InChI | Nenurodyta |
03Statusas Indijoje
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Pavadinimai ir ryšiai
API ir pirminis vaistas
Caffeine
Priemaišos ir susiję junginiaiPavadinimai ir ryšiai
05Šaltiniai
- S01PubChem CID 1326
Structure and machine-readable chemical identifiers.
