Tapatybė
Bicalutamide EP Impurity D
CAS 654-70-6 · C8H5F3N2
01Tapatybė
| Lazychem ID | LC-08202 |
|---|---|
| CAS RN | 654-70-6 |
| PubChem CID | 522170 |
| Molecular formula | C8H5F3N2 |
| Molecular weight | 186.13 g/mol |
| IUPAC name | 4-Amino-2-(trifluoromethyl)benzonitrile |
| InChIKey | PMDYLCUKSLBUHO-UHFFFAOYSA-N |
02Struktūra ir stereochemija
2D structurePubChem CID 522170

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | N#CC1=CC=C(N)C=C1C(F)(F)F |
|---|---|
| InChI | Nenurodyta |
03Statusas Indijoje
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Pavadinimai ir ryšiai
API ir pirminis vaistas
Bicalutamide
Priemaišos ir susiję junginiaiPavadinimai ir ryšiai
- 5-Amino-2-cyanobenzotrifluoride
- 4-cyano-3-(trifluoromethyl)aniline
- 2-trifluoromethyl-4-aminobenzonitrile
05Šaltiniai
- S01PubChem CID 522170
Structure and machine-readable chemical identifiers.
