Identità
7-Methyl Tryptophol
CAS 39232-85-4 · C11H13NO
01Identità
| Lazychem ID | LC-03936 |
|---|---|
| CAS RN | 39232-85-4 |
| PubChem CID | 12272811 |
| Molecular formula | C11H13NO |
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2-(7-methyl-1H-indol-3-yl)ethanol |
| InChIKey | KGZBKPDQVCRMSP-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 12272811

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)CCO |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Tryptophol
Impurezze e composti correlatiNomi e relazioni
- 2-(7-Methyl-1H-indol-3-YL)ethanol
- 39232-85-4
- 7-methyltryptophol
- 7-Methyl-1H-indole-3-ethanol
- 2-(7-methyl-1H-indol-3-yl)ethan-1-ol
- SCHEMBL4803628
- AKOS006310037
05Fonti
- S01PubChem CID 12272811
Structure and machine-readable chemical identifiers.
