Identità
Procainamide N-oxide
CAS 1025964-95-7 · C13H21N3O2
01Identità
| Lazychem ID | LC-26025 |
|---|---|
| CAS RN | 1025964-95-7 |
| PubChem CID | 11402489 |
| Molecular formula | C13H21N3O2 |
| Molecular weight | 251.32 g/mol |
| IUPAC name | 4-Amino-N-[2-(diethyloxidoamino)ethyl]benzamide |
| InChIKey | XZUBTFJLMSLSFU-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 11402489

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | O=C(NCC[N+](CC)(CC)[O-])C1=CC=C(N)C=C1 |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Procainamide
Impurezze e composti correlatiNomi e relazioni
- Benzamide, 4-amino-N-[2-(diethyloxidoamino)ethyl]-
05Fonti
- S01PubChem CID 11402489
Structure and machine-readable chemical identifiers.
