Identità
Nitroglycerin D5
Non indicato · C3D5N3O9
01Identità
| Lazychem ID | LC-23553 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 129010184 |
| Molecular formula | C3D5N3O9 |
| Molecular weight | 232.12 g/mol |
| IUPAC name | Propane-1,2,3-triyl-d5 trinitrate |
| InChIKey | SNIOPGDIGTZGOP-UXXIZXEISA-N |
02Struttura e stereochimica
2D structurePubChem CID 129010184

The parsed structure is acyclic, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | [2H]C([2H])(O[N+]([O-])=O)C([2H])(O[N+]([O-])=O)C([2H])(O[N+]([O-])=O)[2H] |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Nitroglycerin
Impurezze e composti correlatiNomi e relazioni
05Fonti
- S01PubChem CID 129010184
Structure and machine-readable chemical identifiers.
